C13H23N — CID 153319004
(2R)-1-(4,4-dimethylpent-2-ynyl)-2-methylpiperidine (PubChem CID 153319004) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (2R)-1-(4,4-dimethylpent-2-ynyl)-2-methylpiperidine.
| Compound Name | (2R)-1-(4,4-dimethylpent-2-ynyl)-2-methylpiperidine |
|---|---|
| PubChem CID | 153319004 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (2R)-1-(4,4-dimethylpent-2-ynyl)-2-methylpiperidine |
| SMILES | C[C@@H]1CCCCN1CC#CC(C)(C)C |
| InChI | InChI=1S/C13H23N/c1-12-8-5-6-10-14(12)11-7-9-13(2,3)4/h12H,5-6,8,10-11H2,1-4H3/t12-/m1/s1 |
| InChIKey | PKQZDSATKNSWDR-GFCCVEGCSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|