C23H31N8+ — CID 153319039
N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]-4-methyl-3-propan-2-yl-5,10,12-triaza-3-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaen-11-amine (PubChem CID 153319039) has the molecular formula C23H31N8+ and a molecular weight of 419.56 g/mol. Its IUPAC name is N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]-4-methyl-3-propan-2-yl-5,10,12-triaza-3-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaen-11-amine.
| Compound Name | N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]-4-methyl-3-propan-2-yl-5,10,12-triaza-3-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaen-11-amine |
|---|---|
| PubChem CID | 153319039 |
| Molecular Formula | C23H31N8+ |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]-4-methyl-3-propan-2-yl-5,10,12-triaza-3-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaen-11-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4c(n3)C3=[N+](C(C)C)C(C)N=C3C4)nc2)CC1 |
| InChI | InChI=1S/C23H31N8/c1-5-29-8-10-30(11-9-29)18-6-7-20(24-14-18)27-23-25-13-17-12-19-22(21(17)28-23)31(15(2)3)16(4)26-19/h6-7,13-16H,5,8-12H2,1-4H3,(H,24,25,27,28)/q+1 |
| InChIKey | FWDOSDDPMOQMRZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|