C27H35N7 — CID 157414730
N-[5-(4-propan-2-ylpiperazin-1-yl)-2-pyridinyl]spiro[3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-13,1'-cyclohexane]-4-amine (PubChem CID 157414730) has the molecular formula C27H35N7 and a molecular weight of 457.63 g/mol. Its IUPAC name is N-[5-(4-propan-2-ylpiperazin-1-yl)-2-pyridinyl]spiro[3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-13,1'-cyclohexane]-4-amine.
| Compound Name | N-[5-(4-propan-2-ylpiperazin-1-yl)-2-pyridinyl]spiro[3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-13,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 157414730 |
| Molecular Formula | C27H35N7 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | N-[5-(4-propan-2-ylpiperazin-1-yl)-2-pyridinyl]spiro[3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene-13,1'-cyclohexane]-4-amine |
| SMILES | CC(C)N1CCN(c2ccc(Nc3ncc4c(n3)C3=C(C4)N=CCC34CCCCC4)nc2)CC1 |
| InChI | InChI=1S/C27H35N7/c1-19(2)33-12-14-34(15-13-33)21-6-7-23(29-18-21)31-26-30-17-20-16-22-24(25(20)32-26)27(10-11-28-22)8-4-3-5-9-27/h6-7,11,17-19H,3-5,8-10,12-16H2,1-2H3,(H,29,30,31,32) |
| InChIKey | CWCKOUWXOHPVPE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |