C9H16F3NO2 — CID 153321760
propyl (5R)-5-amino-6,6,6-trifluorohexanoate (PubChem CID 153321760) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is propyl (5R)-5-amino-6,6,6-trifluorohexanoate.
| Compound Name | propyl (5R)-5-amino-6,6,6-trifluorohexanoate |
|---|---|
| PubChem CID | 153321760 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | propyl (5R)-5-amino-6,6,6-trifluorohexanoate |
| SMILES | CCCOC(=O)CCC[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c1-2-6-15-8(14)5-3-4-7(13)9(10,11)12/h7H,2-6,13H2,1H3/t7-/m1/s1 |
| InChIKey | HOCJCLIUNCCYNR-SSDOTTSWSA-N |
| XLogP | 2.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |