C13H28N2O4 — CID 153323532
3-[2-[2-[4-(ethylamino)butylamino]ethoxy]ethoxy]propanoic acid (PubChem CID 153323532) has the molecular formula C13H28N2O4 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[2-[2-[4-(ethylamino)butylamino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[4-(ethylamino)butylamino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 153323532 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 3-[2-[2-[4-(ethylamino)butylamino]ethoxy]ethoxy]propanoic acid |
| SMILES | CCNCCCCNCCOCCOCCC(=O)O |
| InChI | InChI=1S/C13H28N2O4/c1-2-14-6-3-4-7-15-8-10-19-12-11-18-9-5-13(16)17/h14-15H,2-12H2,1H3,(H,16,17) |
| InChIKey | BCGQIRXZMRLJGU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|