C6H13NO4S — CID 158696770
3-[2-(methanesulfinamido)ethoxy]propanoic acid (PubChem CID 158696770) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is 3-[2-(methanesulfinamido)ethoxy]propanoic acid.
| Compound Name | 3-[2-(methanesulfinamido)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 158696770 |
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-[2-(methanesulfinamido)ethoxy]propanoic acid |
| SMILES | CS(=O)NCCOCCC(=O)O |
| InChI | InChI=1S/C6H13NO4S/c1-12(10)7-3-5-11-4-2-6(8)9/h7H,2-5H2,1H3,(H,8,9) |
| InChIKey | XALABPAHMLUQGV-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|