C6H12O3S — CID 127003779
3-(2-methylsulfanylethoxy)propanoic acid (PubChem CID 127003779) has the molecular formula C6H12O3S and a molecular weight of 164.23 g/mol. Its IUPAC name is 3-(2-methylsulfanylethoxy)propanoic acid.
| Compound Name | 3-(2-methylsulfanylethoxy)propanoic acid |
|---|---|
| PubChem CID | 127003779 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 3-(2-methylsulfanylethoxy)propanoic acid |
| SMILES | CSCCOCCC(=O)O |
| InChI | InChI=1S/C6H12O3S/c1-10-5-4-9-3-2-6(7)8/h2-5H2,1H3,(H,7,8) |
| InChIKey | DEUCVFQFAGZEJM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|