C16H9OP — CID 153323865
1-phosphorosopyrene (PubChem CID 153323865) has the molecular formula C16H9OP and a molecular weight of 248.22 g/mol. Its IUPAC name is 1-phosphorosopyrene.
| Compound Name | 1-phosphorosopyrene |
|---|---|
| PubChem CID | 153323865 |
| Molecular Formula | C16H9OP |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-phosphorosopyrene |
| SMILES | O=Pc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H9OP/c17-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | RUDFDDHDSQRBMF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|