C14H23F3O4S2 — CID 15332488
[cyclohexyl-methyl-(2-oxocyclohexyl)-lambda4-sulfanyl] trifluoromethanesulfonate (PubChem CID 15332488) has the molecular formula C14H23F3O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is [cyclohexyl-methyl-(2-oxocyclohexyl)-lambda4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [cyclohexyl-methyl-(2-oxocyclohexyl)-lambda4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15332488 |
| Molecular Formula | C14H23F3O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [cyclohexyl-methyl-(2-oxocyclohexyl)-lambda4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CS(OS(=O)(=O)C(F)(F)F)(C1CCCCC1)C1CCCCC1=O |
| InChI | InChI=1S/C14H23F3O4S2/c1-22(11-7-3-2-4-8-11,13-10-6-5-9-12(13)18)21-23(19,20)14(15,16)17/h11,13H,2-10H2,1H3 |
| InChIKey | RSIDRAGZGWOGRH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|