C65H68O8 — CID 153325038
3-methyl-4-[2-[4-[tris[4-[2-(4-hydroxy-2-methylphenyl)propan-2-yl]phenoxy]methoxy]phenyl]propan-2-yl]phenol (PubChem CID 153325038) has the molecular formula C65H68O8 and a molecular weight of 977.25 g/mol. Its IUPAC name is 3-methyl-4-[2-[4-[tris[4-[2-(4-hydroxy-2-methylphenyl)propan-2-yl]phenoxy]methoxy]phenyl]propan-2-yl]phenol.
| Compound Name | 3-methyl-4-[2-[4-[tris[4-[2-(4-hydroxy-2-methylphenyl)propan-2-yl]phenoxy]methoxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 153325038 |
| Molecular Formula | C65H68O8 |
| Molecular Weight | 977.25 g/mol |
| Exact Mass | 976.49 |
| IUPAC Name | 3-methyl-4-[2-[4-[tris[4-[2-(4-hydroxy-2-methylphenyl)propan-2-yl]phenoxy]methoxy]phenyl]propan-2-yl]phenol |
| SMILES | Cc1cc(O)ccc1C(C)(C)c1ccc(OC(Oc2ccc(C(C)(C)c3ccc(O)cc3C)cc2)(Oc2ccc(C(C)(C)c3ccc(O)cc3C)cc2)Oc2ccc(C(C)(C)c3ccc(O)cc3C)cc2)cc1 |
| InChI | InChI=1S/C65H68O8/c1-41-37-49(66)21-33-57(41)61(5,6)45-13-25-53(26-14-45)70-65(71-54-27-15-46(16-28-54)62(7,8)58-34-22-50(67)38-42(58)2,72-55-29-17-47(18-30-55)63(9,10)59-35-23-51(68)39-43(59)3)73-56-31-19-48(20-32-56)64(11,12)60-36-24-52(69)40-44(60)4/h13-40,66-69H,1-12H3 |
| InChIKey | FLQOTCMYQUKLGS-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.25 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|