C28H22F9IO7S2 — CID 153325713
[(4-tert-butylphenyl)-(3-methoxy-9,10,10-trioxothioxanthen-2-yl)-λ3-iodanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 153325713) has the molecular formula C28H22F9IO7S2 and a molecular weight of 832.50 g/mol. Its IUPAC name is [(4-tert-butylphenyl)-(3-methoxy-9,10,10-trioxothioxanthen-2-yl)-λ3-iodanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(4-tert-butylphenyl)-(3-methoxy-9,10,10-trioxothioxanthen-2-yl)-λ3-iodanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 153325713 |
| Molecular Formula | C28H22F9IO7S2 |
| Molecular Weight | 832.50 g/mol |
| Exact Mass | 831.97 |
| IUPAC Name | [(4-tert-butylphenyl)-(3-methoxy-9,10,10-trioxothioxanthen-2-yl)-λ3-iodanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1cc2c(cc1I(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(C(C)(C)C)cc1)C(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C28H22F9IO7S2/c1-24(2,3)15-9-11-16(12-10-15)38(45-47(42,43)28(36,37)26(31,32)25(29,30)27(33,34)35)19-13-18-22(14-20(19)44-4)46(40,41)21-8-6-5-7-17(21)23(18)39/h5-14H,1-4H3 |
| InChIKey | XGRKRAPEDXXIID-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.50 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|