C36H25F9O6S3 — CID 153325716
[[4-[4-(4-methoxybenzoyl)phenyl]sulfinylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 153325716) has the molecular formula C36H25F9O6S3 and a molecular weight of 820.77 g/mol. Its IUPAC name is [[4-[4-(4-methoxybenzoyl)phenyl]sulfinylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-[4-(4-methoxybenzoyl)phenyl]sulfinylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 153325716 |
| Molecular Formula | C36H25F9O6S3 |
| Molecular Weight | 820.77 g/mol |
| Exact Mass | 820.07 |
| IUPAC Name | [[4-[4-(4-methoxybenzoyl)phenyl]sulfinylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(C(=O)c2ccc(S(=O)c3ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H25F9O6S3/c1-50-26-16-12-24(13-17-26)32(46)25-14-18-27(19-15-25)52(47)28-20-22-31(23-21-28)53(29-8-4-2-5-9-29,30-10-6-3-7-11-30)51-54(48,49)36(44,45)34(39,40)33(37,38)35(41,42)43/h2-23H,1H3 |
| InChIKey | WHHNZZLNUIEZKD-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.77 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|