C23H22ClN3O — CID 153328618
[4-[C-[2-(3-chlorophenyl)ethynyl]-N-methylcarbonimidoyl]-3-methylidenepiperazin-1-yl]-(3-methylphenyl)methanone (PubChem CID 153328618) has the molecular formula C23H22ClN3O and a molecular weight of 391.90 g/mol. Its IUPAC name is [4-[C-[2-(3-chlorophenyl)ethynyl]-N-methylcarbonimidoyl]-3-methylidenepiperazin-1-yl]-(3-methylphenyl)methanone.
| Compound Name | [4-[C-[2-(3-chlorophenyl)ethynyl]-N-methylcarbonimidoyl]-3-methylidenepiperazin-1-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 153328618 |
| Molecular Formula | C23H22ClN3O |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [4-[C-[2-(3-chlorophenyl)ethynyl]-N-methylcarbonimidoyl]-3-methylidenepiperazin-1-yl]-(3-methylphenyl)methanone |
| SMILES | C=C1CN(C(=O)c2cccc(C)c2)CCN1/C(C#Cc1cccc(Cl)c1)=N/C |
| InChI | InChI=1S/C23H22ClN3O/c1-17-6-4-8-20(14-17)23(28)26-12-13-27(18(2)16-26)22(25-3)11-10-19-7-5-9-21(24)15-19/h4-9,14-15H,2,12-13,16H2,1,3H3/b25-22+ |
| InChIKey | SDWFLBQHAMZBCX-YYDJUVGSSA-N |
| XLogP | 4.00 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|