C24H24ClNO — CID 137371969
(3-chlorophenyl)-[(4E)-3,3-dimethyl-4-[3-(3-methylphenyl)prop-2-ynylidene]piperidin-1-yl]methanone (PubChem CID 137371969) has the molecular formula C24H24ClNO and a molecular weight of 377.92 g/mol. Its IUPAC name is (3-chlorophenyl)-[(4E)-3,3-dimethyl-4-[3-(3-methylphenyl)prop-2-ynylidene]piperidin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[(4E)-3,3-dimethyl-4-[3-(3-methylphenyl)prop-2-ynylidene]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 137371969 |
| Molecular Formula | C24H24ClNO |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (3-chlorophenyl)-[(4E)-3,3-dimethyl-4-[3-(3-methylphenyl)prop-2-ynylidene]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(C#C/C=C2\CCN(C(=O)c3cccc(Cl)c3)CC2(C)C)c1 |
| InChI | InChI=1S/C24H24ClNO/c1-18-7-4-8-19(15-18)9-5-11-21-13-14-26(17-24(21,2)3)23(27)20-10-6-12-22(25)16-20/h4,6-8,10-12,15-16H,13-14,17H2,1-3H3/b21-11+ |
| InChIKey | OWXODYMAZCAVLQ-SRZZPIQSSA-N |
| XLogP | 5.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|