C24H24ClNO2 — CID 142509071
1-(3-chlorophenyl)-2-[(4E)-4-[3-(3-hydroxyphenyl)prop-2-ynylidene]-3,3-dimethylpiperidin-1-yl]ethanone (PubChem CID 142509071) has the molecular formula C24H24ClNO2 and a molecular weight of 393.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[(4E)-4-[3-(3-hydroxyphenyl)prop-2-ynylidene]-3,3-dimethylpiperidin-1-yl]ethanone.
| Compound Name | 1-(3-chlorophenyl)-2-[(4E)-4-[3-(3-hydroxyphenyl)prop-2-ynylidene]-3,3-dimethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 142509071 |
| Molecular Formula | C24H24ClNO2 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[(4E)-4-[3-(3-hydroxyphenyl)prop-2-ynylidene]-3,3-dimethylpiperidin-1-yl]ethanone |
| SMILES | CC1(C)CN(CC(=O)c2cccc(Cl)c2)CC/C1=C\C#Cc1cccc(O)c1 |
| InChI | InChI=1S/C24H24ClNO2/c1-24(2)17-26(16-23(28)19-8-5-10-21(25)15-19)13-12-20(24)9-3-6-18-7-4-11-22(27)14-18/h4-5,7-11,14-15,27H,12-13,16-17H2,1-2H3/b20-9+ |
| InChIKey | MVNGNILVHUVVKP-AWQFTUOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|