C25H18ClN3O — CID 153328640
3-[2-[9-(3-chlorobenzoyl)-1,9-diazabicyclo[5.4.0]undeca-2,5,6-trien-2-yl]ethynyl]benzonitrile (PubChem CID 153328640) has the molecular formula C25H18ClN3O and a molecular weight of 411.89 g/mol. Its IUPAC name is 3-[2-[9-(3-chlorobenzoyl)-1,9-diazabicyclo[5.4.0]undeca-2,5,6-trien-2-yl]ethynyl]benzonitrile.
| Compound Name | 3-[2-[9-(3-chlorobenzoyl)-1,9-diazabicyclo[5.4.0]undeca-2,5,6-trien-2-yl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 153328640 |
| Molecular Formula | C25H18ClN3O |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 3-[2-[9-(3-chlorobenzoyl)-1,9-diazabicyclo[5.4.0]undeca-2,5,6-trien-2-yl]ethynyl]benzonitrile |
| SMILES | N#Cc1cccc(C#CC2=CCC=C=C3CN(C(=O)c4cccc(Cl)c4)CCN32)c1 |
| InChI | InChI=1S/C25H18ClN3O/c26-22-8-4-7-21(16-22)25(30)28-13-14-29-23(9-1-2-10-24(29)18-28)12-11-19-5-3-6-20(15-19)17-27/h2-9,15-16H,1,13-14,18H2 |
| InChIKey | UDSZIKPQRMWBKI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|