C20H43N3O3 — CID 153328822
tert-butyl 2-(methylaminomethyl)piperidine-1-carboxylate;7-(methylamino)heptan-1-ol (PubChem CID 153328822) has the molecular formula C20H43N3O3 and a molecular weight of 373.58 g/mol. Its IUPAC name is tert-butyl 2-(methylaminomethyl)piperidine-1-carboxylate;7-(methylamino)heptan-1-ol.
| Compound Name | tert-butyl 2-(methylaminomethyl)piperidine-1-carboxylate;7-(methylamino)heptan-1-ol |
|---|---|
| PubChem CID | 153328822 |
| Molecular Formula | C20H43N3O3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | tert-butyl 2-(methylaminomethyl)piperidine-1-carboxylate;7-(methylamino)heptan-1-ol |
| SMILES | CNCC1CCCCN1C(=O)OC(C)(C)C.CNCCCCCCCO |
| InChI | InChI=1S/C12H24N2O2.C8H19NO/c1-12(2,3)16-11(15)14-8-6-5-7-10(14)9-13-4;1-9-7-5-3-2-4-6-8-10/h10,13H,5-9H2,1-4H3;9-10H,2-8H2,1H3 |
| InChIKey | HQACZFGLDFHLNK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|