molecular hydrogen;1-propyl-4-prop-2-ynylbenzene

C12H16 — CID 153330140

IUPACmolecular hydrogen;1-propyl-4-prop-2-ynylbenzene
SMILESC#CCc1ccc(CCC)cc1.[H][H]
InChIInChI=1S/C12H14.H2/c1-3-5-11-7-9-12(6-4-2)10-8-11;/h1,7-10H,4-6H2,2H3;1H
InChIKeyTWDDMMLXELCRME-UHFFFAOYSA-N
MW160.26 g/mol
LogP3.06
Rot. Bonds3

About molecular hydrogen;1-propyl-4-prop-2-ynylbenzene

molecular hydrogen;1-propyl-4-prop-2-ynylbenzene (PubChem CID 153330140) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is molecular hydrogen;1-propyl-4-prop-2-ynylbenzene.

Molecular Properties

Compound Namemolecular hydrogen;1-propyl-4-prop-2-ynylbenzene
PubChem CID153330140
Molecular FormulaC12H16
Molecular Weight160.26 g/mol
Exact Mass160.13
IUPAC Namemolecular hydrogen;1-propyl-4-prop-2-ynylbenzene
SMILESC#CCc1ccc(CCC)cc1.[H][H]
InChIInChI=1S/C12H14.H2/c1-3-5-11-7-9-12(6-4-2)10-8-11;/h1,7-10H,4-6H2,2H3;1H
InChIKeyTWDDMMLXELCRME-UHFFFAOYSA-N
XLogP3.06
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.26
LogP ≤ 53.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze molecular hydrogen;1-propyl-4-prop-2-ynylbenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1-propyl-4-prop-2-ynylbenzene?
The IUPAC name of molecular hydrogen;1-propyl-4-prop-2-ynylbenzene (CID 153330140) is molecular hydrogen;1-propyl-4-prop-2-ynylbenzene.
What is the SMILES notation for molecular hydrogen;1-propyl-4-prop-2-ynylbenzene?
The canonical SMILES for molecular hydrogen;1-propyl-4-prop-2-ynylbenzene is C#CCc1ccc(CCC)cc1.[H][H].
What is the InChIKey of molecular hydrogen;1-propyl-4-prop-2-ynylbenzene?
The InChIKey is TWDDMMLXELCRME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.H2/c1-3-5-11-7-9-12(6-4-2)10-8-11;/h1,7-10H,4-6H2,2H3;1H.
What are the key properties of molecular hydrogen;1-propyl-4-prop-2-ynylbenzene?
molecular hydrogen;1-propyl-4-prop-2-ynylbenzene has a molecular weight of 160.26 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-propyl-4-prop-2-ynylbenzene is sourced from PubChem (CID 153330140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).