C38H58F3N3O4S — CID 153330263
N-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-4-methylaniline;propane-2-thione;2-(trifluoromethyl)-4-(5,5,6-trimethyl-4-oxooctyl)benzonitrile (PubChem CID 153330263) has the molecular formula C38H58F3N3O4S and a molecular weight of 709.96 g/mol. Its IUPAC name is N-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-4-methylaniline;propane-2-thione;2-(trifluoromethyl)-4-(5,5,6-trimethyl-4-oxooctyl)benzonitrile.
| Compound Name | N-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-4-methylaniline;propane-2-thione;2-(trifluoromethyl)-4-(5,5,6-trimethyl-4-oxooctyl)benzonitrile |
|---|---|
| PubChem CID | 153330263 |
| Molecular Formula | C38H58F3N3O4S |
| Molecular Weight | 709.96 g/mol |
| Exact Mass | 709.41 |
| IUPAC Name | N-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-4-methylaniline;propane-2-thione;2-(trifluoromethyl)-4-(5,5,6-trimethyl-4-oxooctyl)benzonitrile |
| SMILES | CC(C)=S.CCC(C)C(C)(C)C(=O)CCCc1ccc(C#N)c(C(F)(F)F)c1.Cc1ccc(NCCCOCCOCCOCCN)cc1 |
| InChI | InChI=1S/C19H24F3NO.C16H28N2O3.C3H6S/c1-5-13(2)18(3,4)17(24)8-6-7-14-9-10-15(12-23)16(11-14)19(20,21)22;1-15-3-5-16(6-4-15)18-8-2-9-19-11-13-21-14-12-20-10-7-17;1-3(2)4/h9-11,13H,5-8H2,1-4H3;3-6,18H,2,7-14,17H2,1H3;1-2H3 |
| InChIKey | PLVBKSKPSKBGNP-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.96 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|