C20H25F3N2OS — CID 163519286
N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2,2,3,4-tetramethylhexanamide (PubChem CID 163519286) has the molecular formula C20H25F3N2OS and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2,2,3,4-tetramethylhexanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2,2,3,4-tetramethylhexanamide |
|---|---|
| PubChem CID | 163519286 |
| Molecular Formula | C20H25F3N2OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2,2,3,4-tetramethylhexanamide |
| SMILES | CCC(C)C(C)C(C)(C)C(=O)N(C(C)=S)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H25F3N2OS/c1-7-12(2)13(3)19(5,6)18(26)25(14(4)27)16-9-8-15(11-24)17(10-16)20(21,22)23/h8-10,12-13H,7H2,1-6H3 |
| InChIKey | DJJJDDNCANPDLX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|