C20H26F3N3O — CID 11959231
(2S,3S)-2-[4-cyano-N-(2-methylprop-2-enyl)-3-(trifluoromethyl)anilino]-N,N,3-trimethylpentanamide (PubChem CID 11959231) has the molecular formula C20H26F3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is (2S,3S)-2-[4-cyano-N-(2-methylprop-2-enyl)-3-(trifluoromethyl)anilino]-N,N,3-trimethylpentanamide.
| Compound Name | (2S,3S)-2-[4-cyano-N-(2-methylprop-2-enyl)-3-(trifluoromethyl)anilino]-N,N,3-trimethylpentanamide |
|---|---|
| PubChem CID | 11959231 |
| Molecular Formula | C20H26F3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | (2S,3S)-2-[4-cyano-N-(2-methylprop-2-enyl)-3-(trifluoromethyl)anilino]-N,N,3-trimethylpentanamide |
| SMILES | C=C(C)CN(c1ccc(C#N)c(C(F)(F)F)c1)[C@H](C(=O)N(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C20H26F3N3O/c1-7-14(4)18(19(27)25(5)6)26(12-13(2)3)16-9-8-15(11-24)17(10-16)20(21,22)23/h8-10,14,18H,2,7,12H2,1,3-6H3/t14-,18-/m0/s1 |
| InChIKey | UHXLJJZJDOSXQK-KSSFIOAISA-N |
| XLogP | 4.46 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|