C17H22F3N3O3 — CID 59776790
2-[4-cyano-N-(2,2-dimethoxyethyl)-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide (PubChem CID 59776790) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-[4-cyano-N-(2,2-dimethoxyethyl)-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide.
| Compound Name | 2-[4-cyano-N-(2,2-dimethoxyethyl)-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 59776790 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[4-cyano-N-(2,2-dimethoxyethyl)-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
| SMILES | COC(CN(c1ccc(C#N)c(C(F)(F)F)c1)C(C)C(=O)N(C)C)OC |
| InChI | InChI=1S/C17H22F3N3O3/c1-11(16(24)22(2)3)23(10-15(25-4)26-5)13-7-6-12(9-21)14(8-13)17(18,19)20/h6-8,11,15H,10H2,1-5H3 |
| InChIKey | WVJSDVGXRQMITI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|