C21H22F3N3O — CID 11960181
2-[N-benzyl-4-cyano-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide (PubChem CID 11960181) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[N-benzyl-4-cyano-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide.
| Compound Name | 2-[N-benzyl-4-cyano-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 11960181 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[N-benzyl-4-cyano-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide |
| SMILES | CCC(C(=O)N(C)C)N(Cc1ccccc1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O/c1-4-19(20(28)26(2)3)27(14-15-8-6-5-7-9-15)17-11-10-16(13-25)18(12-17)21(22,23)24/h5-12,19H,4,14H2,1-3H3 |
| InChIKey | BWESGUGXNYILGH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |