C20H19F3N4O3S2 — CID 143197572
N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2-methyl-2-(3-sulfamoylanilino)propanamide (PubChem CID 143197572) has the molecular formula C20H19F3N4O3S2 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2-methyl-2-(3-sulfamoylanilino)propanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2-methyl-2-(3-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 143197572 |
| Molecular Formula | C20H19F3N4O3S2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethanethioyl-2-methyl-2-(3-sulfamoylanilino)propanamide |
| SMILES | CC(=S)N(C(=O)C(C)(C)Nc1cccc(S(N)(=O)=O)c1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N4O3S2/c1-12(31)27(15-8-7-13(11-24)17(10-15)20(21,22)23)18(28)19(2,3)26-14-5-4-6-16(9-14)32(25,29)30/h4-10,26H,1-3H3,(H2,25,29,30) |
| InChIKey | IQEXCYTVMCAUNB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|