C19H24F2N6OS — CID 153331272
1-[4-[2-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-4-pyridinyl]-6-methylmorpholin-2-yl]-N-methylsulfanylmethanamine (PubChem CID 153331272) has the molecular formula C19H24F2N6OS and a molecular weight of 422.51 g/mol. Its IUPAC name is 1-[4-[2-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-4-pyridinyl]-6-methylmorpholin-2-yl]-N-methylsulfanylmethanamine.
| Compound Name | 1-[4-[2-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-4-pyridinyl]-6-methylmorpholin-2-yl]-N-methylsulfanylmethanamine |
|---|---|
| PubChem CID | 153331272 |
| Molecular Formula | C19H24F2N6OS |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[4-[2-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-4-pyridinyl]-6-methylmorpholin-2-yl]-N-methylsulfanylmethanamine |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2cc(N3CC(C)OC(CNSC)C3)ccn2)[nH]1)C(F)F |
| InChI | InChI=1S/C19H24F2N6OS/c1-12-10-27(11-14(28-12)8-25-29-2)13-5-6-23-16(7-13)17-9-24-18(26-17)4-3-15(22)19(20)21/h3-7,9,12,14,19,22,25H,8,10-11H2,1-2H3,(H,24,26)/b4-3-,22-15- |
| InChIKey | DRKBDEQPDIDZOF-LDSQONOESA-N |
| XLogP | 3.23 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|