C20H28N2O2 — CID 153331969
3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine;2-N-propylbenzene-1,2-diamine (PubChem CID 153331969) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine;2-N-propylbenzene-1,2-diamine.
| Compound Name | 3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine;2-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 153331969 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine;2-N-propylbenzene-1,2-diamine |
| SMILES | CC1(C)COc2ccccc2OC1.CCCNc1ccccc1N |
| InChI | InChI=1S/C11H14O2.C9H14N2/c1-11(2)7-12-9-5-3-4-6-10(9)13-8-11;1-2-7-11-9-6-4-3-5-8(9)10/h3-6H,7-8H2,1-2H3;3-6,11H,2,7,10H2,1H3 |
| InChIKey | MULRLUCPRXHFFP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|