C16H22BrNO6 — CID 153332217
[2-(tert-butylamino)-3-methoxy-3-oxopropyl] 4-bromobenzoate;formic acid (PubChem CID 153332217) has the molecular formula C16H22BrNO6 and a molecular weight of 404.26 g/mol. Its IUPAC name is [2-(tert-butylamino)-3-methoxy-3-oxopropyl] 4-bromobenzoate;formic acid.
| Compound Name | [2-(tert-butylamino)-3-methoxy-3-oxopropyl] 4-bromobenzoate;formic acid |
|---|---|
| PubChem CID | 153332217 |
| Molecular Formula | C16H22BrNO6 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [2-(tert-butylamino)-3-methoxy-3-oxopropyl] 4-bromobenzoate;formic acid |
| SMILES | COC(=O)C(COC(=O)c1ccc(Br)cc1)NC(C)(C)C.O=CO |
| InChI | InChI=1S/C15H20BrNO4.CH2O2/c1-15(2,3)17-12(14(19)20-4)9-21-13(18)10-5-7-11(16)8-6-10;2-1-3/h5-8,12,17H,9H2,1-4H3;1H,(H,2,3) |
| InChIKey | DKUAQWQNBJNDIY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|