C15H21N3OS2 — CID 153333182
2-amino-4-methylsulfanylbutanal;N-methyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 153333182) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanal;N-methyl-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | 2-amino-4-methylsulfanylbutanal;N-methyl-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 153333182 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanal;N-methyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2ccccc2)cs1.CSCCC(N)C=O |
| InChI | InChI=1S/C10H10N2S.C5H11NOS/c1-11-10-12-9(7-13-10)8-5-3-2-4-6-8;1-8-3-2-5(6)4-7/h2-7H,1H3,(H,11,12);4-5H,2-3,6H2,1H3 |
| InChIKey | PFUZAWFEXFCIPY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|