C21H27N3OS — CID 153333964
2-[1-(methylamino)ethenylsulfanyl]-3-[4-[3-[methyl(pyridin-2-yl)amino]propyl]phenyl]propanal (PubChem CID 153333964) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-[1-(methylamino)ethenylsulfanyl]-3-[4-[3-[methyl(pyridin-2-yl)amino]propyl]phenyl]propanal.
| Compound Name | 2-[1-(methylamino)ethenylsulfanyl]-3-[4-[3-[methyl(pyridin-2-yl)amino]propyl]phenyl]propanal |
|---|---|
| PubChem CID | 153333964 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[1-(methylamino)ethenylsulfanyl]-3-[4-[3-[methyl(pyridin-2-yl)amino]propyl]phenyl]propanal |
| SMILES | C=C(NC)SC(C=O)Cc1ccc(CCCN(C)c2ccccn2)cc1 |
| InChI | InChI=1S/C21H27N3OS/c1-17(22-2)26-20(16-25)15-19-11-9-18(10-12-19)7-6-14-24(3)21-8-4-5-13-23-21/h4-5,8-13,16,20,22H,1,6-7,14-15H2,2-3H3 |
| InChIKey | LEGHNJRDNSQQJB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|