C15H27NO — CID 153333975
ethane;(3Z)-5-methyl-N-(oxan-4-ylmethyl)hexa-1,3,5-trien-2-amine (PubChem CID 153333975) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(3Z)-5-methyl-N-(oxan-4-ylmethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | ethane;(3Z)-5-methyl-N-(oxan-4-ylmethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 153333975 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;(3Z)-5-methyl-N-(oxan-4-ylmethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=C)NCC1CCOCC1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-11(2)4-5-12(3)14-10-13-6-8-15-9-7-13;1-2/h4-5,13-14H,1,3,6-10H2,2H3;1-2H3/b5-4-; |
| InChIKey | MXRSWNMBIQHVLS-MKWAYWHRSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|