C29H28F2IN2O3PS — CID 153334488
(4-fluoro-2,6-dimethylphenyl)-[3-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]methanone (PubChem CID 153334488) has the molecular formula C29H28F2IN2O3PS and a molecular weight of 680.50 g/mol. Its IUPAC name is (4-fluoro-2,6-dimethylphenyl)-[3-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]methanone.
| Compound Name | (4-fluoro-2,6-dimethylphenyl)-[3-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 153334488 |
| Molecular Formula | C29H28F2IN2O3PS |
| Molecular Weight | 680.50 g/mol |
| Exact Mass | 680.06 |
| IUPAC Name | (4-fluoro-2,6-dimethylphenyl)-[3-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]methanone |
| SMILES | Cc1cc(F)cc(C)c1C(=O)c1sc2cc(OPI)ccc2c1Oc1ccc(NC2CN(CCCF)C2)cc1 |
| InChI | InChI=1S/C29H28F2IN2O3PS/c1-17-12-19(31)13-18(2)26(17)27(35)29-28(24-9-8-23(37-38-32)14-25(24)39-29)36-22-6-4-20(5-7-22)33-21-15-34(16-21)11-3-10-30/h4-9,12-14,21,33,38H,3,10-11,15-16H2,1-2H3 |
| InChIKey | PWULUFXQALVJMJ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.50 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|