C27H24FINO4PS — CID 153334486
[3-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 153334486) has the molecular formula C27H24FINO4PS and a molecular weight of 635.44 g/mol. Its IUPAC name is [3-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]-phenylmethanone.
| Compound Name | [3-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 153334486 |
| Molecular Formula | C27H24FINO4PS |
| Molecular Weight | 635.44 g/mol |
| Exact Mass | 635.02 |
| IUPAC Name | [3-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenoxy]-6-iodophosphanyloxy-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1sc2cc(OPI)ccc2c1Oc1ccc(OCCN2CC(CF)C2)cc1 |
| InChI | InChI=1S/C27H24FINO4PS/c28-15-18-16-30(17-18)12-13-32-20-6-8-21(9-7-20)33-26-23-11-10-22(34-35-29)14-24(23)36-27(26)25(31)19-4-2-1-3-5-19/h1-11,14,18,35H,12-13,15-17H2 |
| InChIKey | PYGWZXQXDBXEGL-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.44 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|