C30H29FO4S — CID 163818638
[3-[4-[4-[3-(fluoromethyl)cyclobutyl]butoxy]phenoxy]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 163818638) has the molecular formula C30H29FO4S and a molecular weight of 504.62 g/mol. Its IUPAC name is [3-[4-[4-[3-(fluoromethyl)cyclobutyl]butoxy]phenoxy]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone.
| Compound Name | [3-[4-[4-[3-(fluoromethyl)cyclobutyl]butoxy]phenoxy]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 163818638 |
| Molecular Formula | C30H29FO4S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | [3-[4-[4-[3-(fluoromethyl)cyclobutyl]butoxy]phenoxy]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1sc2cc(O)ccc2c1Oc1ccc(OCCCCC2CC(CF)C2)cc1 |
| InChI | InChI=1S/C30H29FO4S/c31-19-21-16-20(17-21)6-4-5-15-34-24-10-12-25(13-11-24)35-29-26-14-9-23(32)18-27(26)36-30(29)28(33)22-7-2-1-3-8-22/h1-3,7-14,18,20-21,32H,4-6,15-17,19H2 |
| InChIKey | NTNCPDUJEWGPML-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|