C27H26FNO4S — CID 166984246
[3-[(3Z)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hexa-1,3,5-trien-2-yl]oxy-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 166984246) has the molecular formula C27H26FNO4S and a molecular weight of 479.57 g/mol. Its IUPAC name is [3-[(3Z)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hexa-1,3,5-trien-2-yl]oxy-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone.
| Compound Name | [3-[(3Z)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hexa-1,3,5-trien-2-yl]oxy-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 166984246 |
| Molecular Formula | C27H26FNO4S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [3-[(3Z)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hexa-1,3,5-trien-2-yl]oxy-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | C=C(/C=C\C(=C)Oc1c(C(=O)c2ccccc2)sc2cc(O)ccc12)OCCN1CC(CF)C1 |
| InChI | InChI=1S/C27H26FNO4S/c1-18(32-13-12-29-16-20(15-28)17-29)8-9-19(2)33-26-23-11-10-22(30)14-24(23)34-27(26)25(31)21-6-4-3-5-7-21/h3-11,14,20,30H,1-2,12-13,15-17H2/b9-8- |
| InChIKey | LFQLBVXDWSXNHK-HJWRWDBZSA-N |
| XLogP | 5.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|