C29H26N2O5S — CID 162516283
(E)-4-[3-[4-[(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]azetidin-1-yl]-N-methylbut-2-enamide (PubChem CID 162516283) has the molecular formula C29H26N2O5S and a molecular weight of 514.60 g/mol. Its IUPAC name is (E)-4-[3-[4-[(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]azetidin-1-yl]-N-methylbut-2-enamide.
| Compound Name | (E)-4-[3-[4-[(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]azetidin-1-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 162516283 |
| Molecular Formula | C29H26N2O5S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | (E)-4-[3-[4-[(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)oxy]phenoxy]azetidin-1-yl]-N-methylbut-2-enamide |
| SMILES | CNC(=O)/C=C/CN1CC(Oc2ccc(Oc3c(C(=O)c4ccccc4)sc4cc(O)ccc34)cc2)C1 |
| InChI | InChI=1S/C29H26N2O5S/c1-30-26(33)8-5-15-31-17-23(18-31)35-21-10-12-22(13-11-21)36-28-24-14-9-20(32)16-25(24)37-29(28)27(34)19-6-3-2-4-7-19/h2-14,16,23,32H,15,17-18H2,1H3,(H,30,33)/b8-5+ |
| InChIKey | SVHSGVFOWQUBQX-VMPITWQZSA-N |
| XLogP | 5.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|