C27H25NO3S — CID 57407053
(6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(1-propylazetidin-3-yl)oxyphenyl]methanone (PubChem CID 57407053) has the molecular formula C27H25NO3S and a molecular weight of 443.57 g/mol. Its IUPAC name is (6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(1-propylazetidin-3-yl)oxyphenyl]methanone.
| Compound Name | (6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(1-propylazetidin-3-yl)oxyphenyl]methanone |
|---|---|
| PubChem CID | 57407053 |
| Molecular Formula | C27H25NO3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(1-propylazetidin-3-yl)oxyphenyl]methanone |
| SMILES | CCCN1CC(Oc2ccc(C(=O)c3c(-c4ccccc4)sc4cc(O)ccc34)cc2)C1 |
| InChI | InChI=1S/C27H25NO3S/c1-2-14-28-16-22(17-28)31-21-11-8-18(9-12-21)26(30)25-23-13-10-20(29)15-24(23)32-27(25)19-6-4-3-5-7-19/h3-13,15,22,29H,2,14,16-17H2,1H3 |
| InChIKey | LBJCPSYPVHTAER-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |