C29H27NO4S — CID 175934196
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(1-prop-2-enylpiperidin-4-yl)oxyphenyl]methanone (PubChem CID 175934196) has the molecular formula C29H27NO4S and a molecular weight of 485.61 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(1-prop-2-enylpiperidin-4-yl)oxyphenyl]methanone.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(1-prop-2-enylpiperidin-4-yl)oxyphenyl]methanone |
|---|---|
| PubChem CID | 175934196 |
| Molecular Formula | C29H27NO4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(1-prop-2-enylpiperidin-4-yl)oxyphenyl]methanone |
| SMILES | C=CCN1CCC(Oc2ccc(C(=O)c3c(-c4ccc(O)cc4)sc4cc(O)ccc34)cc2)CC1 |
| InChI | InChI=1S/C29H27NO4S/c1-2-15-30-16-13-24(14-17-30)34-23-10-5-19(6-11-23)28(33)27-25-12-9-22(32)18-26(25)35-29(27)20-3-7-21(31)8-4-20/h2-12,18,24,31-32H,1,13-17H2 |
| InChIKey | QFHIJZBZQIXZRX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|