C28H25ClFNO3S — CID 138580964
(2-chlorophenyl)-[3-[4-[3-[3-(fluoromethyl)azetidin-1-yl]propoxy]phenyl]-6-hydroxy-1-benzothiophen-2-yl]methanone (PubChem CID 138580964) has the molecular formula C28H25ClFNO3S and a molecular weight of 510.03 g/mol. Its IUPAC name is (2-chlorophenyl)-[3-[4-[3-[3-(fluoromethyl)azetidin-1-yl]propoxy]phenyl]-6-hydroxy-1-benzothiophen-2-yl]methanone.
| Compound Name | (2-chlorophenyl)-[3-[4-[3-[3-(fluoromethyl)azetidin-1-yl]propoxy]phenyl]-6-hydroxy-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 138580964 |
| Molecular Formula | C28H25ClFNO3S |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (2-chlorophenyl)-[3-[4-[3-[3-(fluoromethyl)azetidin-1-yl]propoxy]phenyl]-6-hydroxy-1-benzothiophen-2-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)c1sc2cc(O)ccc2c1-c1ccc(OCCCN2CC(CF)C2)cc1 |
| InChI | InChI=1S/C28H25ClFNO3S/c29-24-5-2-1-4-22(24)27(33)28-26(23-11-8-20(32)14-25(23)35-28)19-6-9-21(10-7-19)34-13-3-12-31-16-18(15-30)17-31/h1-2,4-11,14,18,32H,3,12-13,15-17H2 |
| InChIKey | JPTFRBNSBHZYLG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|