C39H62N4O10 — CID 153336262
4-[(4-methylcyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide (PubChem CID 153336262) has the molecular formula C39H62N4O10 and a molecular weight of 746.94 g/mol. Its IUPAC name is 4-[(4-methylcyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide.
| Compound Name | 4-[(4-methylcyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
|---|---|
| PubChem CID | 153336262 |
| Molecular Formula | C39H62N4O10 |
| Molecular Weight | 746.94 g/mol |
| Exact Mass | 746.45 |
| IUPAC Name | 4-[(4-methylcyclohexanecarbonyl)amino]-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-N,N'-bis[2-(2-prop-2-ynoxyethoxy)ethyl]heptanediamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C39H62N4O10/c1-5-21-48-27-30-51-24-18-40-35(44)12-15-39(43-38(47)34-10-8-33(4)9-11-34,16-13-36(45)41-19-25-52-31-28-49-22-6-2)17-14-37(46)42-20-26-53-32-29-50-23-7-3/h1-3,33-34H,8-32H2,4H3,(H,40,44)(H,41,45)(H,42,46)(H,43,47) |
| InChIKey | XZPXTBVZQCHHNZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.94 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|