About (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol
(Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol (PubChem CID 153336613) has the molecular formula C17H20S2
and a molecular weight of 288.48 g/mol. Its IUPAC name is (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol.
Molecular Properties
| Compound Name | (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol |
| PubChem CID | 153336613 |
| Molecular Formula | C17H20S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol |
| SMILES | CC(C)c1cccc(/C(S)=C(/S)C2=CC=CCC2)c1 |
| InChI | InChI=1S/C17H20S2/c1-12(2)14-9-6-10-15(11-14)17(19)16(18)13-7-4-3-5-8-13/h3-4,6-7,9-12,18-19H,5,8H2,1-2H3/b17-16- |
| InChIKey | XHFHVDSQDUVQCV-MSUUIHNZSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol?
The IUPAC name of (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol (CID 153336613) is (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol.
What is the SMILES notation for (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol?
The canonical SMILES for (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol is CC(C)c1cccc(/C(S)=C(/S)C2=CC=CCC2)c1.
What is the InChIKey of (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol?
The InChIKey is XHFHVDSQDUVQCV-MSUUIHNZSA-N. The full InChI is InChI=1S/C17H20S2/c1-12(2)14-9-6-10-15(11-14)17(19)16(18)13-7-4-3-5-8-13/h3-4,6-7,9-12,18-19H,5,8H2,1-2H3/b17-16-.
What are the key properties of (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol?
(Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol has a molecular weight of 288.48 g/mol, XLogP of 5.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol is sourced from PubChem (CID 153336613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).