C17H20S2 — CID 153336613
(Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol (PubChem CID 153336613) has the molecular formula C17H20S2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol.
| Compound Name | (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol |
|---|---|
| PubChem CID | 153336613 |
| Molecular Formula | C17H20S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (Z)-1-cyclohexa-1,3-dien-1-yl-2-(3-propan-2-ylphenyl)ethene-1,2-dithiol |
| SMILES | CC(C)c1cccc(/C(S)=C(/S)C2=CC=CCC2)c1 |
| InChI | InChI=1S/C17H20S2/c1-12(2)14-9-6-10-15(11-14)17(19)16(18)13-7-4-3-5-8-13/h3-4,6-7,9-12,18-19H,5,8H2,1-2H3/b17-16- |
| InChIKey | XHFHVDSQDUVQCV-MSUUIHNZSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|