C16H16F5N3O2S2 — CID 153337055
(E)-2-amino-3-hydrazinyl-3-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methylsulfanyl]prop-2-enoic acid (PubChem CID 153337055) has the molecular formula C16H16F5N3O2S2 and a molecular weight of 441.45 g/mol. Its IUPAC name is (E)-2-amino-3-hydrazinyl-3-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methylsulfanyl]prop-2-enoic acid.
| Compound Name | (E)-2-amino-3-hydrazinyl-3-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methylsulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 153337055 |
| Molecular Formula | C16H16F5N3O2S2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (E)-2-amino-3-hydrazinyl-3-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methylsulfanyl]prop-2-enoic acid |
| SMILES | NN/C(SCc1ccc(-c2ccc(S(F)(F)(F)(F)F)cc2)cc1)=C(\N)C(=O)O |
| InChI | InChI=1S/C16H16F5N3O2S2/c17-28(18,19,20,21)13-7-5-12(6-8-13)11-3-1-10(2-4-11)9-27-15(24-23)14(22)16(25)26/h1-8,24H,9,22-23H2,(H,25,26)/b15-14+ |
| InChIKey | ZSAMDLHPFCKCAR-CCEZHUSRSA-N |
| XLogP | 4.92 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|