C30H43FN4 — CID 153337095
acetylene;(3E,5E)-N-[3-[3-fluoro-5-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]phenyl]prop-1-en-2-yl]-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-amine (PubChem CID 153337095) has the molecular formula C30H43FN4 and a molecular weight of 478.70 g/mol. Its IUPAC name is acetylene;(3E,5E)-N-[3-[3-fluoro-5-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]phenyl]prop-1-en-2-yl]-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-amine.
| Compound Name | acetylene;(3E,5E)-N-[3-[3-fluoro-5-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]phenyl]prop-1-en-2-yl]-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 153337095 |
| Molecular Formula | C30H43FN4 |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | acetylene;(3E,5E)-N-[3-[3-fluoro-5-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]phenyl]prop-1-en-2-yl]-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-amine |
| SMILES | C#C.C=C/C(=C\C=C(/C)CC1CCN(C)CC1)NC(=C)Cc1cc(F)cc(C(C)(C)/C=N\NC)c1 |
| InChI | InChI=1S/C28H41FN4.C2H2/c1-8-27(10-9-21(2)15-23-11-13-33(7)14-12-23)32-22(3)16-24-17-25(19-26(29)18-24)28(4,5)20-31-30-6;1-2/h8-10,17-20,23,30,32H,1,3,11-16H2,2,4-7H3;1-2H/b21-9+,27-10+,31-20-; |
| InChIKey | BHKJAOPDSIFZCY-ACDHQLSPSA-N |
| XLogP | 5.95 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|