C28H43N5 — CID 153337110
4-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]-2-[2-[[(3E,5E)-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-yl]amino]prop-2-enyl]aniline (PubChem CID 153337110) has the molecular formula C28H43N5 and a molecular weight of 449.69 g/mol. Its IUPAC name is 4-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]-2-[2-[[(3E,5E)-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-yl]amino]prop-2-enyl]aniline.
| Compound Name | 4-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]-2-[2-[[(3E,5E)-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-yl]amino]prop-2-enyl]aniline |
|---|---|
| PubChem CID | 153337110 |
| Molecular Formula | C28H43N5 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | 4-[(1Z)-2-methyl-1-(methylhydrazinylidene)propan-2-yl]-2-[2-[[(3E,5E)-6-methyl-7-(1-methylpiperidin-4-yl)hepta-1,3,5-trien-3-yl]amino]prop-2-enyl]aniline |
| SMILES | C=C/C(=C\C=C(/C)CC1CCN(C)CC1)NC(=C)Cc1cc(C(C)(C)/C=N\NC)ccc1N |
| InChI | InChI=1S/C28H43N5/c1-8-26(11-9-21(2)17-23-13-15-33(7)16-14-23)32-22(3)18-24-19-25(10-12-27(24)29)28(4,5)20-31-30-6/h8-12,19-20,23,30,32H,1,3,13-18,29H2,2,4-7H3/b21-9+,26-11+,31-20- |
| InChIKey | LXZAAQTWGGJPRD-PKPONBORSA-N |
| XLogP | 5.15 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|