About 6-chloropyridazine-3-carboxylic acid;propane
6-chloropyridazine-3-carboxylic acid;propane (PubChem CID 153337925) has the molecular formula C8H11ClN2O2
and a molecular weight of 202.64 g/mol. Its IUPAC name is 6-chloropyridazine-3-carboxylic acid;propane.
Molecular Properties
| Compound Name | 6-chloropyridazine-3-carboxylic acid;propane |
| PubChem CID | 153337925 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 6-chloropyridazine-3-carboxylic acid;propane |
| SMILES | CCC.O=C(O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C5H3ClN2O2.C3H8/c6-4-2-1-3(5(9)10)7-8-4;1-3-2/h1-2H,(H,9,10);3H2,1-2H3 |
| InChIKey | FGINTYJDDMQNFG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloropyridazine-3-carboxylic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridazine-3-carboxylic acid;propane?
The IUPAC name of 6-chloropyridazine-3-carboxylic acid;propane (CID 153337925) is 6-chloropyridazine-3-carboxylic acid;propane.
What is the SMILES notation for 6-chloropyridazine-3-carboxylic acid;propane?
The canonical SMILES for 6-chloropyridazine-3-carboxylic acid;propane is CCC.O=C(O)c1ccc(Cl)nn1.
What is the InChIKey of 6-chloropyridazine-3-carboxylic acid;propane?
The InChIKey is FGINTYJDDMQNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O2.C3H8/c6-4-2-1-3(5(9)10)7-8-4;1-3-2/h1-2H,(H,9,10);3H2,1-2H3.
What are the key properties of 6-chloropyridazine-3-carboxylic acid;propane?
6-chloropyridazine-3-carboxylic acid;propane has a molecular weight of 202.64 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridazine-3-carboxylic acid;propane is sourced from PubChem (CID 153337925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).