C26H27N5O4S — CID 153339201
4-(2,6-dimethoxyphenyl)-5-(6-ethoxy-2-pyridinyl)-N-(2-phenylethylsulfanyl)-1,2,4-triazole-3-carboxamide (PubChem CID 153339201) has the molecular formula C26H27N5O4S and a molecular weight of 505.60 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-5-(6-ethoxy-2-pyridinyl)-N-(2-phenylethylsulfanyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 4-(2,6-dimethoxyphenyl)-5-(6-ethoxy-2-pyridinyl)-N-(2-phenylethylsulfanyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 153339201 |
| Molecular Formula | C26H27N5O4S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-5-(6-ethoxy-2-pyridinyl)-N-(2-phenylethylsulfanyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCOc1cccc(-c2nnc(C(=O)NSCCc3ccccc3)n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C26H27N5O4S/c1-4-35-22-15-8-12-19(27-22)24-28-29-25(26(32)30-36-17-16-18-10-6-5-7-11-18)31(24)23-20(33-2)13-9-14-21(23)34-3/h5-15H,4,16-17H2,1-3H3,(H,30,32) |
| InChIKey | RUPHBCMQNMKFQC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|