C28H56N4O4S2 — CID 153341746
2-[2-[2-[3-[[(E)-4-[3-[tert-butyl(ethyl)amino]propylamino]but-2-enyl]amino]propyl-ethylcarbamoyl]oxyethylsulfanyl]propan-2-ylsulfanyl]ethyl acetate (PubChem CID 153341746) has the molecular formula C28H56N4O4S2 and a molecular weight of 576.91 g/mol. Its IUPAC name is 2-[2-[2-[3-[[(E)-4-[3-[tert-butyl(ethyl)amino]propylamino]but-2-enyl]amino]propyl-ethylcarbamoyl]oxyethylsulfanyl]propan-2-ylsulfanyl]ethyl acetate.
| Compound Name | 2-[2-[2-[3-[[(E)-4-[3-[tert-butyl(ethyl)amino]propylamino]but-2-enyl]amino]propyl-ethylcarbamoyl]oxyethylsulfanyl]propan-2-ylsulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 153341746 |
| Molecular Formula | C28H56N4O4S2 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | 2-[2-[2-[3-[[(E)-4-[3-[tert-butyl(ethyl)amino]propylamino]but-2-enyl]amino]propyl-ethylcarbamoyl]oxyethylsulfanyl]propan-2-ylsulfanyl]ethyl acetate |
| SMILES | CCN(CCCNC/C=C/CNCCCN(CC)C(C)(C)C)C(=O)OCCSC(C)(C)SCCOC(C)=O |
| InChI | InChI=1S/C28H56N4O4S2/c1-9-31(26(34)36-22-24-38-28(7,8)37-23-21-35-25(3)33)19-13-17-29-15-11-12-16-30-18-14-20-32(10-2)27(4,5)6/h11-12,29-30H,9-10,13-24H2,1-8H3/b12-11+ |
| InChIKey | ZDUJGGSZXZAYFU-VAWYXSNFSA-N |
| XLogP | 4.85 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|