C9H13NS — CID 153342683
N,5-dimethyl-3-propan-2-ylidenethiophen-2-imine (PubChem CID 153342683) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N,5-dimethyl-3-propan-2-ylidenethiophen-2-imine.
| Compound Name | N,5-dimethyl-3-propan-2-ylidenethiophen-2-imine |
|---|---|
| PubChem CID | 153342683 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N,5-dimethyl-3-propan-2-ylidenethiophen-2-imine |
| SMILES | C/N=C1\SC(C)=CC1=C(C)C |
| InChI | InChI=1S/C9H13NS/c1-6(2)8-5-7(3)11-9(8)10-4/h5H,1-4H3/b10-9- |
| InChIKey | MRPIGICWOGCBED-KTKRTIGZSA-N |
| XLogP | 3.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|