C12H11NSY2-2 — CID 59400358
2-phenyl-5-propan-2-yl-4H-1,3-thiazol-4-ide;bis(yttrium) (PubChem CID 59400358) has the molecular formula C12H11NSY2-2 and a molecular weight of 379.11 g/mol. Its IUPAC name is 2-phenyl-5-propan-2-yl-4H-1,3-thiazol-4-ide;bis(yttrium).
| Compound Name | 2-phenyl-5-propan-2-yl-4H-1,3-thiazol-4-ide;bis(yttrium) |
|---|---|
| PubChem CID | 59400358 |
| Molecular Formula | C12H11NSY2-2 |
| Molecular Weight | 379.11 g/mol |
| Exact Mass | 378.87 |
| IUPAC Name | 2-phenyl-5-propan-2-yl-4H-1,3-thiazol-4-ide;bis(yttrium) |
| SMILES | CC(C)c1[c-]nc(-c2cc[c-]cc2)s1.[Y].[Y] |
| InChI | InChI=1S/C12H11NS.2Y/c1-9(2)11-8-13-12(14-11)10-6-4-3-5-7-10;;/h4-7,9H,1-2H3;;/q-2;; |
| InChIKey | YMZSZFQSIIMDMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|