C8H12FN3O3 — CID 153342826
N'-fluoro-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanehydrazide (PubChem CID 153342826) has the molecular formula C8H12FN3O3 and a molecular weight of 217.20 g/mol. Its IUPAC name is N'-fluoro-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanehydrazide.
| Compound Name | N'-fluoro-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 153342826 |
| Molecular Formula | C8H12FN3O3 |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N'-fluoro-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanehydrazide |
| SMILES | CC1CC(=O)N(CCC(=O)NNF)C1=O |
| InChI | InChI=1S/C8H12FN3O3/c1-5-4-7(14)12(8(5)15)3-2-6(13)10-11-9/h5,11H,2-4H2,1H3,(H,10,13) |
| InChIKey | KWTKWIHTWDRNDG-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|