About (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite
(2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite (PubChem CID 153343697) has the molecular formula C9H7IN2OS
and a molecular weight of 318.14 g/mol. Its IUPAC name is (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite |
| PubChem CID | 153343697 |
| Molecular Formula | C9H7IN2OS |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite |
| SMILES | Cc1cnc2cc(C=O)n(SI)c2c1 |
| InChI | InChI=1S/C9H7IN2OS/c1-6-2-9-8(11-4-6)3-7(5-13)12(9)14-10/h2-5H,1H3 |
| InChIKey | HDRXLTKPVQBWIU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite?
The IUPAC name of (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite (CID 153343697) is (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite.
What is the SMILES notation for (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite?
The canonical SMILES for (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite is Cc1cnc2cc(C=O)n(SI)c2c1.
What is the InChIKey of (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite?
The InChIKey is HDRXLTKPVQBWIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IN2OS/c1-6-2-9-8(11-4-6)3-7(5-13)12(9)14-10/h2-5H,1H3.
What are the key properties of (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite?
(2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite has a molecular weight of 318.14 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formyl-6-methylpyrrolo[3,2-b]pyridin-1-yl) thiohypoiodite is sourced from PubChem (CID 153343697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).